C25H26N2O3 — CID 46409789
3-benzamido-N,4-dimethyl-N-[2-(2-methylphenoxy)ethyl]benzamide (PubChem CID 46409789) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 3-benzamido-N,4-dimethyl-N-[2-(2-methylphenoxy)ethyl]benzamide.
| Compound Name | 3-benzamido-N,4-dimethyl-N-[2-(2-methylphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 46409789 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 3-benzamido-N,4-dimethyl-N-[2-(2-methylphenoxy)ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)N(C)CCOc2ccccc2C)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O3/c1-18-13-14-21(17-22(18)26-24(28)20-10-5-4-6-11-20)25(29)27(3)15-16-30-23-12-8-7-9-19(23)2/h4-14,17H,15-16H2,1-3H3,(H,26,28) |
| InChIKey | DBJOLATZJWOWAN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |