C18H19Cl2NO4 — CID 112798057
3-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-5-ethoxy-4-hydroxy-N-methylbenzamide (PubChem CID 112798057) has the molecular formula C18H19Cl2NO4 and a molecular weight of 384.26 g/mol. Its IUPAC name is 3-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-5-ethoxy-4-hydroxy-N-methylbenzamide.
| Compound Name | 3-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-5-ethoxy-4-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 112798057 |
| Molecular Formula | C18H19Cl2NO4 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 3-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-5-ethoxy-4-hydroxy-N-methylbenzamide |
| SMILES | CCOc1cc(C(=O)N(C)Cc2cc(Cl)ccc2OC)cc(Cl)c1O |
| InChI | InChI=1S/C18H19Cl2NO4/c1-4-25-16-9-11(8-14(20)17(16)22)18(23)21(2)10-12-7-13(19)5-6-15(12)24-3/h5-9,22H,4,10H2,1-3H3 |
| InChIKey | PEILAIMEEYZNLE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |