C17H17ClN2O4 — CID 32762970
methyl 6-[(5-chloro-2-methoxyphenyl)methyl-methylcarbamoyl]pyridine-3-carboxylate (PubChem CID 32762970) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is methyl 6-[(5-chloro-2-methoxyphenyl)methyl-methylcarbamoyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[(5-chloro-2-methoxyphenyl)methyl-methylcarbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 32762970 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | methyl 6-[(5-chloro-2-methoxyphenyl)methyl-methylcarbamoyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)N(C)Cc2cc(Cl)ccc2OC)nc1 |
| InChI | InChI=1S/C17H17ClN2O4/c1-20(10-12-8-13(18)5-7-15(12)23-2)16(21)14-6-4-11(9-19-14)17(22)24-3/h4-9H,10H2,1-3H3 |
| InChIKey | XJKYGFOXIKLPDI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |