C18H20ClNO2 — CID 32760905
N-[(5-chloro-2-methoxyphenyl)methyl]-N,2,3-trimethylbenzamide (PubChem CID 32760905) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-N,2,3-trimethylbenzamide.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N,2,3-trimethylbenzamide |
|---|---|
| PubChem CID | 32760905 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N,2,3-trimethylbenzamide |
| SMILES | COc1ccc(Cl)cc1CN(C)C(=O)c1cccc(C)c1C |
| InChI | InChI=1S/C18H20ClNO2/c1-12-6-5-7-16(13(12)2)18(21)20(3)11-14-10-15(19)8-9-17(14)22-4/h5-10H,11H2,1-4H3 |
| InChIKey | SKJJCVJGDSJKRY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |