C17H17Cl2NO3 — CID 18112013
2,5-dichloro-N-[(2,3-dimethoxyphenyl)methyl]-N-methylbenzamide (PubChem CID 18112013) has the molecular formula C17H17Cl2NO3 and a molecular weight of 354.23 g/mol. Its IUPAC name is 2,5-dichloro-N-[(2,3-dimethoxyphenyl)methyl]-N-methylbenzamide.
| Compound Name | 2,5-dichloro-N-[(2,3-dimethoxyphenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 18112013 |
| Molecular Formula | C17H17Cl2NO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2,5-dichloro-N-[(2,3-dimethoxyphenyl)methyl]-N-methylbenzamide |
| SMILES | COc1cccc(CN(C)C(=O)c2cc(Cl)ccc2Cl)c1OC |
| InChI | InChI=1S/C17H17Cl2NO3/c1-20(17(21)13-9-12(18)7-8-14(13)19)10-11-5-4-6-15(22-2)16(11)23-3/h4-9H,10H2,1-3H3 |
| InChIKey | XPBWOBGWBKMKAA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |