C18H20ClNO4S — CID 9183059
N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-4-(methylsulfonylmethyl)benzamide (PubChem CID 9183059) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 9183059 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-4-(methylsulfonylmethyl)benzamide |
| SMILES | COc1ccc(Cl)cc1CN(C)C(=O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H20ClNO4S/c1-20(11-15-10-16(19)8-9-17(15)24-2)18(21)14-6-4-13(5-7-14)12-25(3,22)23/h4-10H,11-12H2,1-3H3 |
| InChIKey | CNLTUORCMVTBJC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |