C19H21ClN2O5S — CID 55330028
N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methyl-4-(methylsulfonylmethyl)benzamide (PubChem CID 55330028) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methyl-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methyl-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 55330028 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methyl-4-(methylsulfonylmethyl)benzamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN(C)C(=O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H21ClN2O5S/c1-22(11-18(23)21-16-10-15(20)8-9-17(16)27-2)19(24)14-6-4-13(5-7-14)12-28(3,25)26/h4-10H,11-12H2,1-3H3,(H,21,23) |
| InChIKey | BDLQJIJDQXPBEX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |