C16H14Cl3N3O3 — CID 55329725
5,6-dichloro-N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methylpyridine-3-carboxamide (PubChem CID 55329725) has the molecular formula C16H14Cl3N3O3 and a molecular weight of 402.67 g/mol. Its IUPAC name is 5,6-dichloro-N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methylpyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 55329725 |
| Molecular Formula | C16H14Cl3N3O3 |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 5,6-dichloro-N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methylpyridine-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN(C)C(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl3N3O3/c1-22(16(24)9-5-11(18)15(19)20-7-9)8-14(23)21-12-6-10(17)3-4-13(12)25-2/h3-7H,8H2,1-2H3,(H,21,23) |
| InChIKey | LHOZIHOEPONKTI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|