C15H14BrClN2O4 — CID 9438199
5-bromo-N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methylfuran-2-carboxamide (PubChem CID 9438199) has the molecular formula C15H14BrClN2O4 and a molecular weight of 401.64 g/mol. Its IUPAC name is 5-bromo-N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 9438199 |
| Molecular Formula | C15H14BrClN2O4 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | 5-bromo-N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methylfuran-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN(C)C(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H14BrClN2O4/c1-19(15(21)12-5-6-13(16)23-12)8-14(20)18-10-7-9(17)3-4-11(10)22-2/h3-7H,8H2,1-2H3,(H,18,20) |
| InChIKey | DXRJAEDJJHDMIX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |