C15H17ClN2O2 — CID 18120198
4-chloro-N-methyl-N-[2-(2-methylphenoxy)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 18120198) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 4-chloro-N-methyl-N-[2-(2-methylphenoxy)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-methyl-N-[2-(2-methylphenoxy)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18120198 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-chloro-N-methyl-N-[2-(2-methylphenoxy)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1ccccc1OCCN(C)C(=O)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C15H17ClN2O2/c1-11-5-3-4-6-14(11)20-8-7-18(2)15(19)13-9-12(16)10-17-13/h3-6,9-10,17H,7-8H2,1-2H3 |
| InChIKey | ZWPQKMMQEJIKHB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |