C24H30N2O5 — CID 55457672
3-ethoxy-N-(2-hydroxy-2-phenylethyl)-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide (PubChem CID 55457672) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-ethoxy-N-(2-hydroxy-2-phenylethyl)-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide.
| Compound Name | 3-ethoxy-N-(2-hydroxy-2-phenylethyl)-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide |
|---|---|
| PubChem CID | 55457672 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 3-ethoxy-N-(2-hydroxy-2-phenylethyl)-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)NCC(O)c2ccccc2)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C24H30N2O5/c1-2-30-22-15-19(24(29)25-16-20(27)18-9-5-3-6-10-18)11-12-21(22)31-17-23(28)26-13-7-4-8-14-26/h3,5-6,9-12,15,20,27H,2,4,7-8,13-14,16-17H2,1H3,(H,25,29) |
| InChIKey | LTKYWJPDARQATK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |