C19H22FN2O+ — CID 4742848
(4-fluorophenyl)-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]methanone (PubChem CID 4742848) has the molecular formula C19H22FN2O+ and a molecular weight of 313.40 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 4742848 |
| Molecular Formula | C19H22FN2O+ |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (4-fluorophenyl)-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]methanone |
| SMILES | Cc1ccccc1C[NH+]1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H21FN2O/c1-15-4-2-3-5-17(15)14-21-10-12-22(13-11-21)19(23)16-6-8-18(20)9-7-16/h2-9H,10-14H2,1H3/p+1 |
| InChIKey | DKYJSJGXZRTZSE-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |