C20H25N4O2+ — CID 9162581
[3-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-carbonyl]phenyl]urea (PubChem CID 9162581) has the molecular formula C20H25N4O2+ and a molecular weight of 353.45 g/mol. Its IUPAC name is [3-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-carbonyl]phenyl]urea.
| Compound Name | [3-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-carbonyl]phenyl]urea |
|---|---|
| PubChem CID | 9162581 |
| Molecular Formula | C20H25N4O2+ |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [3-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-carbonyl]phenyl]urea |
| SMILES | Cc1ccccc1C[NH+]1CCN(C(=O)c2cccc(NC(N)=O)c2)CC1 |
| InChI | InChI=1S/C20H24N4O2/c1-15-5-2-3-6-17(15)14-23-9-11-24(12-10-23)19(25)16-7-4-8-18(13-16)22-20(21)26/h2-8,13H,9-12,14H2,1H3,(H3,21,22,26)/p+1 |
| InChIKey | RTMVYLMVGOOQNJ-UHFFFAOYSA-O |
| XLogP | 1.03 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |