C19H22F2N3O+ — CID 7189289
N-(2,4-difluorophenyl)-4-(2-phenylethyl)piperazin-4-ium-1-carboxamide (PubChem CID 7189289) has the molecular formula C19H22F2N3O+ and a molecular weight of 346.40 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(2-phenylethyl)piperazin-4-ium-1-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-4-(2-phenylethyl)piperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 7189289 |
| Molecular Formula | C19H22F2N3O+ |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(2-phenylethyl)piperazin-4-ium-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)N1CC[NH+](CCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H21F2N3O/c20-16-6-7-18(17(21)14-16)22-19(25)24-12-10-23(11-13-24)9-8-15-4-2-1-3-5-15/h1-7,14H,8-13H2,(H,22,25)/p+1 |
| InChIKey | NSXAYBGVSQBBDO-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |