C26H35N2O2+ — CID 6963042
(4-methylpiperidin-1-yl)-[1-[(4-phenylmethoxyphenyl)methyl]piperidin-1-ium-4-yl]methanone (PubChem CID 6963042) has the molecular formula C26H35N2O2+ and a molecular weight of 407.58 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[1-[(4-phenylmethoxyphenyl)methyl]piperidin-1-ium-4-yl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[1-[(4-phenylmethoxyphenyl)methyl]piperidin-1-ium-4-yl]methanone |
|---|---|
| PubChem CID | 6963042 |
| Molecular Formula | C26H35N2O2+ |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[1-[(4-phenylmethoxyphenyl)methyl]piperidin-1-ium-4-yl]methanone |
| SMILES | CC1CCN(C(=O)C2CC[NH+](Cc3ccc(OCc4ccccc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H34N2O2/c1-21-11-17-28(18-12-21)26(29)24-13-15-27(16-14-24)19-22-7-9-25(10-8-22)30-20-23-5-3-2-4-6-23/h2-10,21,24H,11-20H2,1H3/p+1 |
| InChIKey | MQGOVLVEKYPJSL-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |