C20H28N2O+2 — CID 6943042
1-ethyl-4-[(4-phenylmethoxyphenyl)methyl]piperazine-1,4-diium (PubChem CID 6943042) has the molecular formula C20H28N2O+2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-ethyl-4-[(4-phenylmethoxyphenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1-ethyl-4-[(4-phenylmethoxyphenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 6943042 |
| Molecular Formula | C20H28N2O+2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 1-ethyl-4-[(4-phenylmethoxyphenyl)methyl]piperazine-1,4-diium |
| SMILES | CC[NH+]1CC[NH+](Cc2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C20H26N2O/c1-2-21-12-14-22(15-13-21)16-18-8-10-20(11-9-18)23-17-19-6-4-3-5-7-19/h3-11H,2,12-17H2,1H3/p+2 |
| InChIKey | JLTXVLMENAZLNM-UHFFFAOYSA-P |
| XLogP | 0.57 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |