C22H32N2O+2 — CID 4124603
benzyl-[1-[(4-ethoxyphenyl)methyl]piperidin-1-ium-4-yl]-methylazanium (PubChem CID 4124603) has the molecular formula C22H32N2O+2 and a molecular weight of 340.51 g/mol. Its IUPAC name is benzyl-[1-[(4-ethoxyphenyl)methyl]piperidin-1-ium-4-yl]-methylazanium.
| Compound Name | benzyl-[1-[(4-ethoxyphenyl)methyl]piperidin-1-ium-4-yl]-methylazanium |
|---|---|
| PubChem CID | 4124603 |
| Molecular Formula | C22H32N2O+2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | benzyl-[1-[(4-ethoxyphenyl)methyl]piperidin-1-ium-4-yl]-methylazanium |
| SMILES | CCOc1ccc(C[NH+]2CCC([NH+](C)Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H30N2O/c1-3-25-22-11-9-20(10-12-22)18-24-15-13-21(14-16-24)23(2)17-19-7-5-4-6-8-19/h4-12,21H,3,13-18H2,1-2H3/p+2 |
| InChIKey | PSPQYQCAIXEOBG-UHFFFAOYSA-P |
| XLogP | 1.35 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |