C27H34N2O+2 — CID 11905044
benzyl-[(3R,4S)-1-benzyl-3-(4-ethoxyphenyl)piperidin-1-ium-4-yl]azanium (PubChem CID 11905044) has the molecular formula C27H34N2O+2 and a molecular weight of 402.58 g/mol. Its IUPAC name is benzyl-[(3R,4S)-1-benzyl-3-(4-ethoxyphenyl)piperidin-1-ium-4-yl]azanium.
| Compound Name | benzyl-[(3R,4S)-1-benzyl-3-(4-ethoxyphenyl)piperidin-1-ium-4-yl]azanium |
|---|---|
| PubChem CID | 11905044 |
| Molecular Formula | C27H34N2O+2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | benzyl-[(3R,4S)-1-benzyl-3-(4-ethoxyphenyl)piperidin-1-ium-4-yl]azanium |
| SMILES | CCOc1ccc([C@@H]2C[NH+](Cc3ccccc3)CC[C@@H]2[NH2+]Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H32N2O/c1-2-30-25-15-13-24(14-16-25)26-21-29(20-23-11-7-4-8-12-23)18-17-27(26)28-19-22-9-5-3-6-10-22/h3-16,26-28H,2,17-21H2,1H3/p+2/t26-,27-/m0/s1 |
| InChIKey | MENHDFSNXLOASS-SVBPBHIXSA-P |
| XLogP | 2.79 |
| TPSA | 30.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |