C28H39N2O2+ — CID 6961826
N-(1-benzylpiperidin-1-ium-4-yl)-N-[(4-ethoxyphenyl)methyl]cyclohexanecarboxamide (PubChem CID 6961826) has the molecular formula C28H39N2O2+ and a molecular weight of 435.63 g/mol. Its IUPAC name is N-(1-benzylpiperidin-1-ium-4-yl)-N-[(4-ethoxyphenyl)methyl]cyclohexanecarboxamide.
| Compound Name | N-(1-benzylpiperidin-1-ium-4-yl)-N-[(4-ethoxyphenyl)methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 6961826 |
| Molecular Formula | C28H39N2O2+ |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | N-(1-benzylpiperidin-1-ium-4-yl)-N-[(4-ethoxyphenyl)methyl]cyclohexanecarboxamide |
| SMILES | CCOc1ccc(CN(C(=O)C2CCCCC2)C2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H38N2O2/c1-2-32-27-15-13-24(14-16-27)22-30(28(31)25-11-7-4-8-12-25)26-17-19-29(20-18-26)21-23-9-5-3-6-10-23/h3,5-6,9-10,13-16,25-26H,2,4,7-8,11-12,17-22H2,1H3/p+1 |
| InChIKey | AVESUUXVIOETQU-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |