C44H46N2O8 — CID 19069170
3,4-bis[cyclopentyl-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,2-dicarboxylic acid (PubChem CID 19069170) has the molecular formula C44H46N2O8 and a molecular weight of 730.86 g/mol. Its IUPAC name is 3,4-bis[cyclopentyl-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,2-dicarboxylic acid.
| Compound Name | 3,4-bis[cyclopentyl-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 19069170 |
| Molecular Formula | C44H46N2O8 |
| Molecular Weight | 730.86 g/mol |
| Exact Mass | 730.33 |
| IUPAC Name | 3,4-bis[cyclopentyl-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1C(C(=O)O)C(C(=O)N(Cc2ccc(Oc3ccccc3)cc2)C2CCCC2)C1C(=O)N(Cc1ccc(Oc2ccccc2)cc1)C1CCCC1 |
| InChI | InChI=1S/C44H46N2O8/c47-41(45(31-11-7-8-12-31)27-29-19-23-35(24-20-29)53-33-15-3-1-4-16-33)37-38(40(44(51)52)39(37)43(49)50)42(48)46(32-13-9-10-14-32)28-30-21-25-36(26-22-30)54-34-17-5-2-6-18-34/h1-6,15-26,31-32,37-40H,7-14,27-28H2,(H,49,50)(H,51,52) |
| InChIKey | JSZDCPKBSNNNMF-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.86 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |