C44H38N2O10 — CID 19048170
2,4-bis[furan-2-ylmethyl-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,3-dicarboxylic acid (PubChem CID 19048170) has the molecular formula C44H38N2O10 and a molecular weight of 754.79 g/mol. Its IUPAC name is 2,4-bis[furan-2-ylmethyl-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis[furan-2-ylmethyl-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 19048170 |
| Molecular Formula | C44H38N2O10 |
| Molecular Weight | 754.79 g/mol |
| Exact Mass | 754.25 |
| IUPAC Name | 2,4-bis[furan-2-ylmethyl-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1C(C(=O)N(Cc2ccc(Oc3ccccc3)cc2)Cc2ccco2)C(C(=O)O)C1C(=O)N(Cc1ccc(Oc2ccccc2)cc1)Cc1ccco1 |
| InChI | InChI=1S/C44H38N2O10/c47-41(45(27-35-13-7-23-53-35)25-29-15-19-33(20-16-29)55-31-9-3-1-4-10-31)37-39(43(49)50)38(40(37)44(51)52)42(48)46(28-36-14-8-24-54-36)26-30-17-21-34(22-18-30)56-32-11-5-2-6-12-32/h1-24,37-40H,25-28H2,(H,49,50)(H,51,52) |
| InChIKey | HNBYZLQRSRDONB-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 159.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.79 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |