C44H38N2O8S2 — CID 19069334
3,4-bis[(4-phenoxyphenyl)methyl-(thiophen-2-ylmethyl)carbamoyl]cyclobutane-1,2-dicarboxylic acid (PubChem CID 19069334) has the molecular formula C44H38N2O8S2 and a molecular weight of 786.93 g/mol. Its IUPAC name is 3,4-bis[(4-phenoxyphenyl)methyl-(thiophen-2-ylmethyl)carbamoyl]cyclobutane-1,2-dicarboxylic acid.
| Compound Name | 3,4-bis[(4-phenoxyphenyl)methyl-(thiophen-2-ylmethyl)carbamoyl]cyclobutane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 19069334 |
| Molecular Formula | C44H38N2O8S2 |
| Molecular Weight | 786.93 g/mol |
| Exact Mass | 786.21 |
| IUPAC Name | 3,4-bis[(4-phenoxyphenyl)methyl-(thiophen-2-ylmethyl)carbamoyl]cyclobutane-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1C(C(=O)O)C(C(=O)N(Cc2ccc(Oc3ccccc3)cc2)Cc2cccs2)C1C(=O)N(Cc1ccc(Oc2ccccc2)cc1)Cc1cccs1 |
| InChI | InChI=1S/C44H38N2O8S2/c47-41(45(27-35-13-7-23-55-35)25-29-15-19-33(20-16-29)53-31-9-3-1-4-10-31)37-38(40(44(51)52)39(37)43(49)50)42(48)46(28-36-14-8-24-56-36)26-30-17-21-34(22-18-30)54-32-11-5-2-6-12-32/h1-24,37-40H,25-28H2,(H,49,50)(H,51,52) |
| InChIKey | PYFWDXWDYPQKDQ-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.93 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |