C39H43N3O6 — CID 18664036
(1R,2R,3R,4R)-2-amino-3,4-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 18664036) has the molecular formula C39H43N3O6 and a molecular weight of 649.79 g/mol. Its IUPAC name is (1R,2R,3R,4R)-2-amino-3,4-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | (1R,2R,3R,4R)-2-amino-3,4-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 18664036 |
| Molecular Formula | C39H43N3O6 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.32 |
| IUPAC Name | (1R,2R,3R,4R)-2-amino-3,4-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | CCCN(Cc1ccc(Oc2ccccc2)cc1)C(=O)[C@H]1[C@@H](C(=O)O)[C@H](N)[C@@H]1C(=O)N(CCC)Cc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C39H43N3O6/c1-3-23-41(25-27-15-19-31(20-16-27)47-29-11-7-5-8-12-29)37(43)33-34(36(40)35(33)39(45)46)38(44)42(24-4-2)26-28-17-21-32(22-18-28)48-30-13-9-6-10-14-30/h5-22,33-36H,3-4,23-26,40H2,1-2H3,(H,45,46)/t33-,34-,35-,36-/m1/s1 |
| InChIKey | MDXOJVXNENWFGO-MGXDLYCJSA-N |
| XLogP | 6.72 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |