C40H42N2O8S2 — CID 18663890
(1R,2R,3R,4R)-3,4-bis[2-methylsulfanylethyl-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,2-dicarboxylic acid (PubChem CID 18663890) has the molecular formula C40H42N2O8S2 and a molecular weight of 742.92 g/mol. Its IUPAC name is (1R,2R,3R,4R)-3,4-bis[2-methylsulfanylethyl-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,2-dicarboxylic acid.
| Compound Name | (1R,2R,3R,4R)-3,4-bis[2-methylsulfanylethyl-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 18663890 |
| Molecular Formula | C40H42N2O8S2 |
| Molecular Weight | 742.92 g/mol |
| Exact Mass | 742.24 |
| IUPAC Name | (1R,2R,3R,4R)-3,4-bis[2-methylsulfanylethyl-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,2-dicarboxylic acid |
| SMILES | CSCCN(Cc1ccc(Oc2ccccc2)cc1)C(=O)[C@H]1[C@@H](C(=O)O)[C@H](C(=O)O)[C@@H]1C(=O)N(CCSC)Cc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C40H42N2O8S2/c1-51-23-21-41(25-27-13-17-31(18-14-27)49-29-9-5-3-6-10-29)37(43)33-34(36(40(47)48)35(33)39(45)46)38(44)42(22-24-52-2)26-28-15-19-32(20-16-28)50-30-11-7-4-8-12-30/h3-20,33-36H,21-26H2,1-2H3,(H,45,46)(H,47,48)/t33-,34-,35-,36-/m1/s1 |
| InChIKey | DFVMDXNCPYAOAG-MGXDLYCJSA-N |
| XLogP | 7.00 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.92 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |