C36H32Cl2N2O6 — CID 19048208
2,4-bis[benzyl-[(4-chlorophenyl)methyl]carbamoyl]cyclobutane-1,3-dicarboxylic acid (PubChem CID 19048208) has the molecular formula C36H32Cl2N2O6 and a molecular weight of 659.57 g/mol. Its IUPAC name is 2,4-bis[benzyl-[(4-chlorophenyl)methyl]carbamoyl]cyclobutane-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis[benzyl-[(4-chlorophenyl)methyl]carbamoyl]cyclobutane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 19048208 |
| Molecular Formula | C36H32Cl2N2O6 |
| Molecular Weight | 659.57 g/mol |
| Exact Mass | 658.16 |
| IUPAC Name | 2,4-bis[benzyl-[(4-chlorophenyl)methyl]carbamoyl]cyclobutane-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1C(C(=O)N(Cc2ccccc2)Cc2ccc(Cl)cc2)C(C(=O)O)C1C(=O)N(Cc1ccccc1)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H32Cl2N2O6/c37-27-15-11-25(12-16-27)21-39(19-23-7-3-1-4-8-23)33(41)29-31(35(43)44)30(32(29)36(45)46)34(42)40(20-24-9-5-2-6-10-24)22-26-13-17-28(38)18-14-26/h1-18,29-32H,19-22H2,(H,43,44)(H,45,46) |
| InChIKey | ZZWMLIOOHDSJEZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |