C46H50N2O6 — CID 22872918
2,4-bis[benzyl-[(E,2R)-2-methyl-5-phenylpent-4-enyl]carbamoyl]cyclobutane-1,3-dicarboxylic acid (PubChem CID 22872918) has the molecular formula C46H50N2O6 and a molecular weight of 726.91 g/mol. Its IUPAC name is 2,4-bis[benzyl-[(E,2R)-2-methyl-5-phenylpent-4-enyl]carbamoyl]cyclobutane-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis[benzyl-[(E,2R)-2-methyl-5-phenylpent-4-enyl]carbamoyl]cyclobutane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 22872918 |
| Molecular Formula | C46H50N2O6 |
| Molecular Weight | 726.91 g/mol |
| Exact Mass | 726.37 |
| IUPAC Name | 2,4-bis[benzyl-[(E,2R)-2-methyl-5-phenylpent-4-enyl]carbamoyl]cyclobutane-1,3-dicarboxylic acid |
| SMILES | C[C@H](C/C=C/c1ccccc1)CN(Cc1ccccc1)C(=O)C1C(C(=O)O)C(C(=O)N(Cc2ccccc2)C[C@H](C)C/C=C/c2ccccc2)C1C(=O)O |
| InChI | InChI=1S/C46H50N2O6/c1-33(17-15-27-35-19-7-3-8-20-35)29-47(31-37-23-11-5-12-24-37)43(49)39-41(45(51)52)40(42(39)46(53)54)44(50)48(32-38-25-13-6-14-26-38)30-34(2)18-16-28-36-21-9-4-10-22-36/h3-16,19-28,33-34,39-42H,17-18,29-32H2,1-2H3,(H,51,52)(H,53,54)/b27-15+,28-16+/t33-,34-,39?,40?,41?,42?/m1/s1 |
| InChIKey | VVKVTHOAKYXSOE-ZFCOOUPGSA-N |
| XLogP | 8.17 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.91 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |