C24H32N2O2 — CID 108523671
N,N-dibenzyl-N',N'-bis(2-methylpropyl)oxamide (PubChem CID 108523671) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is N,N-dibenzyl-N',N'-bis(2-methylpropyl)oxamide.
| Compound Name | N,N-dibenzyl-N',N'-bis(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 108523671 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | N,N-dibenzyl-N',N'-bis(2-methylpropyl)oxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H32N2O2/c1-19(2)15-25(16-20(3)4)23(27)24(28)26(17-21-11-7-5-8-12-21)18-22-13-9-6-10-14-22/h5-14,19-20H,15-18H2,1-4H3 |
| InChIKey | MPEAAJNKQXCOCV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|