C15H22N2O5 — CID 108509868
N'-benzyl-N,N,N'-tris(2-hydroxyethyl)oxamide (PubChem CID 108509868) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is N'-benzyl-N,N,N'-tris(2-hydroxyethyl)oxamide.
| Compound Name | N'-benzyl-N,N,N'-tris(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108509868 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N'-benzyl-N,N,N'-tris(2-hydroxyethyl)oxamide |
| SMILES | O=C(C(=O)N(CCO)Cc1ccccc1)N(CCO)CCO |
| InChI | InChI=1S/C15H22N2O5/c18-9-6-16(7-10-19)14(21)15(22)17(8-11-20)12-13-4-2-1-3-5-13/h1-5,18-20H,6-12H2 |
| InChIKey | SXCREDLNNBMZNG-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|