C11H13F2NO2 — CID 103513904
N-benzyl-2,2-difluoro-N-(2-hydroxyethyl)acetamide (PubChem CID 103513904) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is N-benzyl-2,2-difluoro-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2,2-difluoro-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 103513904 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-benzyl-2,2-difluoro-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C(C(F)F)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C11H13F2NO2/c12-10(13)11(16)14(6-7-15)8-9-4-2-1-3-5-9/h1-5,10,15H,6-8H2 |
| InChIKey | FKZUCQBLQHMLQD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |