C19H22N2O3 — CID 108518757
N,N'-dibenzyl-N'-(2-hydroxyethyl)-N-methyloxamide (PubChem CID 108518757) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N,N'-dibenzyl-N'-(2-hydroxyethyl)-N-methyloxamide.
| Compound Name | N,N'-dibenzyl-N'-(2-hydroxyethyl)-N-methyloxamide |
|---|---|
| PubChem CID | 108518757 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N,N'-dibenzyl-N'-(2-hydroxyethyl)-N-methyloxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-20(14-16-8-4-2-5-9-16)18(23)19(24)21(12-13-22)15-17-10-6-3-7-11-17/h2-11,22H,12-15H2,1H3 |
| InChIKey | JPHCJKMNOLITRJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|