C16H25N3O3 — CID 108523741
N'-benzyl-N-[3-(dimethylamino)propyl]-N'-(2-hydroxyethyl)oxamide (PubChem CID 108523741) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is N'-benzyl-N-[3-(dimethylamino)propyl]-N'-(2-hydroxyethyl)oxamide.
| Compound Name | N'-benzyl-N-[3-(dimethylamino)propyl]-N'-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108523741 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N'-benzyl-N-[3-(dimethylamino)propyl]-N'-(2-hydroxyethyl)oxamide |
| SMILES | CN(C)CCCNC(=O)C(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C16H25N3O3/c1-18(2)10-6-9-17-15(21)16(22)19(11-12-20)13-14-7-4-3-5-8-14/h3-5,7-8,20H,6,9-13H2,1-2H3,(H,17,21) |
| InChIKey | BQZIHILKEGAAQA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|