C11H11NO4 — CID 130891258
3-[benzyl(methyl)amino]-2,3-dioxopropanoic acid (PubChem CID 130891258) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 3-[benzyl(methyl)amino]-2,3-dioxopropanoic acid.
| Compound Name | 3-[benzyl(methyl)amino]-2,3-dioxopropanoic acid |
|---|---|
| PubChem CID | 130891258 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 3-[benzyl(methyl)amino]-2,3-dioxopropanoic acid |
| SMILES | CN(Cc1ccccc1)C(=O)C(=O)C(=O)O |
| InChI | InChI=1S/C11H11NO4/c1-12(10(14)9(13)11(15)16)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | OEHAKDPNWCFCLT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|