C26H28N2O4 — CID 3309530
1-N,3-N-dibenzyl-1-N,3-N-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide (PubChem CID 3309530) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-N,3-N-dibenzyl-1-N,3-N-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-dibenzyl-1-N,3-N-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3309530 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 1-N,3-N-dibenzyl-1-N,3-N-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(c1cccc(C(=O)N(CCO)Cc2ccccc2)c1)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C26H28N2O4/c29-16-14-27(19-21-8-3-1-4-9-21)25(31)23-12-7-13-24(18-23)26(32)28(15-17-30)20-22-10-5-2-6-11-22/h1-13,18,29-30H,14-17,19-20H2 |
| InChIKey | HJJSCDURWFPGPI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |