C18H36N2O2 — CID 4523531
N,N,N',N'-tetrakis(2-methylpropyl)oxamide (PubChem CID 4523531) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(2-methylpropyl)oxamide.
| Compound Name | N,N,N',N'-tetrakis(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 4523531 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | N,N,N',N'-tetrakis(2-methylpropyl)oxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)C(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C18H36N2O2/c1-13(2)9-19(10-14(3)4)17(21)18(22)20(11-15(5)6)12-16(7)8/h13-16H,9-12H2,1-8H3 |
| InChIKey | WQYCBQGBEHIPPY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|