C9H19NO2S — CID 174893639
sulfanyl N,N-bis(2-methylpropyl)carbamate (PubChem CID 174893639) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is sulfanyl N,N-bis(2-methylpropyl)carbamate.
| Compound Name | sulfanyl N,N-bis(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 174893639 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | sulfanyl N,N-bis(2-methylpropyl)carbamate |
| SMILES | CC(C)CN(CC(C)C)C(=O)OS |
| InChI | InChI=1S/C9H19NO2S/c1-7(2)5-10(6-8(3)4)9(11)12-13/h7-8,13H,5-6H2,1-4H3 |
| InChIKey | HBSAQQBLXJGCPC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|