C12H24N2O5 — CID 21309176
tert-butyl N-[(2S)-2-hydroxy-3-(hydroxyamino)-3-oxopropyl]-N-(2-methylpropyl)carbamate (PubChem CID 21309176) has the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-hydroxy-3-(hydroxyamino)-3-oxopropyl]-N-(2-methylpropyl)carbamate.
| Compound Name | tert-butyl N-[(2S)-2-hydroxy-3-(hydroxyamino)-3-oxopropyl]-N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 21309176 |
| Molecular Formula | C12H24N2O5 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | tert-butyl N-[(2S)-2-hydroxy-3-(hydroxyamino)-3-oxopropyl]-N-(2-methylpropyl)carbamate |
| SMILES | CC(C)CN(C[C@H](O)C(=O)NO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24N2O5/c1-8(2)6-14(7-9(15)10(16)13-18)11(17)19-12(3,4)5/h8-9,15,18H,6-7H2,1-5H3,(H,13,16)/t9-/m0/s1 |
| InChIKey | ZMMKQWWJCQFOPT-VIFPVBQESA-N |
| XLogP | 0.75 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|