C12H25NO4 — CID 143525018
tert-butyl N-(2,2-dihydroxyethyl)-N-(2,2-dimethylpropyl)carbamate (PubChem CID 143525018) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is tert-butyl N-(2,2-dihydroxyethyl)-N-(2,2-dimethylpropyl)carbamate.
| Compound Name | tert-butyl N-(2,2-dihydroxyethyl)-N-(2,2-dimethylpropyl)carbamate |
|---|---|
| PubChem CID | 143525018 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | tert-butyl N-(2,2-dihydroxyethyl)-N-(2,2-dimethylpropyl)carbamate |
| SMILES | CC(C)(C)CN(CC(O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25NO4/c1-11(2,3)8-13(7-9(14)15)10(16)17-12(4,5)6/h9,14-15H,7-8H2,1-6H3 |
| InChIKey | VZEQUCQMJALGHT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|