C15H31NO4 — CID 165352440
tert-butyl N,N-bis(2-hydroxypentyl)carbamate (PubChem CID 165352440) has the molecular formula C15H31NO4 and a molecular weight of 289.42 g/mol. Its IUPAC name is tert-butyl N,N-bis(2-hydroxypentyl)carbamate.
| Compound Name | tert-butyl N,N-bis(2-hydroxypentyl)carbamate |
|---|---|
| PubChem CID | 165352440 |
| Molecular Formula | C15H31NO4 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | tert-butyl N,N-bis(2-hydroxypentyl)carbamate |
| SMILES | CCCC(O)CN(CC(O)CCC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H31NO4/c1-6-8-12(17)10-16(11-13(18)9-7-2)14(19)20-15(3,4)5/h12-13,17-18H,6-11H2,1-5H3 |
| InChIKey | REYMAIGNHDZXDL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |