C30H60N2O4 — CID 142044544
tert-butyl N-[2-[[(2-methylpropan-2-yl)oxycarbonyl-pentylamino]methyl]nonyl]-N-pentylcarbamate (PubChem CID 142044544) has the molecular formula C30H60N2O4 and a molecular weight of 512.82 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2-methylpropan-2-yl)oxycarbonyl-pentylamino]methyl]nonyl]-N-pentylcarbamate.
| Compound Name | tert-butyl N-[2-[[(2-methylpropan-2-yl)oxycarbonyl-pentylamino]methyl]nonyl]-N-pentylcarbamate |
|---|---|
| PubChem CID | 142044544 |
| Molecular Formula | C30H60N2O4 |
| Molecular Weight | 512.82 g/mol |
| Exact Mass | 512.46 |
| IUPAC Name | tert-butyl N-[2-[[(2-methylpropan-2-yl)oxycarbonyl-pentylamino]methyl]nonyl]-N-pentylcarbamate |
| SMILES | CCCCCCCC(CN(CCCCC)C(=O)OC(C)(C)C)CN(CCCCC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H60N2O4/c1-10-13-16-17-18-21-26(24-31(22-19-14-11-2)27(33)35-29(4,5)6)25-32(23-20-15-12-3)28(34)36-30(7,8)9/h26H,10-25H2,1-9H3 |
| InChIKey | IMDXGPGDUIQCBF-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.82 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|