C13H25NO5 — CID 91296592
ethyl 3-[2-hydroxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 91296592) has the molecular formula C13H25NO5 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethyl 3-[2-hydroxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | ethyl 3-[2-hydroxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 91296592 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | ethyl 3-[2-hydroxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(CC(C)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO5/c1-6-18-11(16)7-8-14(9-10(2)15)12(17)19-13(3,4)5/h10,15H,6-9H2,1-5H3 |
| InChIKey | BIPTVZJUOYPFQM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |