C10H22N2O3 — CID 97184684
tert-butyl N-(2-aminoethyl)-N-[(2S)-2-hydroxypropyl]carbamate (PubChem CID 97184684) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is tert-butyl N-(2-aminoethyl)-N-[(2S)-2-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-(2-aminoethyl)-N-[(2S)-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 97184684 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | tert-butyl N-(2-aminoethyl)-N-[(2S)-2-hydroxypropyl]carbamate |
| SMILES | C[C@H](O)CN(CCN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H22N2O3/c1-8(13)7-12(6-5-11)9(14)15-10(2,3)4/h8,13H,5-7,11H2,1-4H3/t8-/m0/s1 |
| InChIKey | VLXYEQXFLYGVFK-QMMMGPOBSA-N |
| XLogP | 0.56 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |