C13H26N2O4 — CID 107257085
tert-butyl N-(2-hydroxypropyl)-N-[2-(oxetan-3-ylamino)ethyl]carbamate (PubChem CID 107257085) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxypropyl)-N-[2-(oxetan-3-ylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-(2-hydroxypropyl)-N-[2-(oxetan-3-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 107257085 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | tert-butyl N-(2-hydroxypropyl)-N-[2-(oxetan-3-ylamino)ethyl]carbamate |
| SMILES | CC(O)CN(CCNC1COC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H26N2O4/c1-10(16)7-15(12(17)19-13(2,3)4)6-5-14-11-8-18-9-11/h10-11,14,16H,5-9H2,1-4H3 |
| InChIKey | OLYBOYOTCABJMJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |