C15H31N3O3 — CID 107257034
tert-butyl N-(2-hydroxypropyl)-N-[2-[(1-methylpyrrolidin-3-yl)amino]ethyl]carbamate (PubChem CID 107257034) has the molecular formula C15H31N3O3 and a molecular weight of 301.43 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxypropyl)-N-[2-[(1-methylpyrrolidin-3-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-(2-hydroxypropyl)-N-[2-[(1-methylpyrrolidin-3-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 107257034 |
| Molecular Formula | C15H31N3O3 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | tert-butyl N-(2-hydroxypropyl)-N-[2-[(1-methylpyrrolidin-3-yl)amino]ethyl]carbamate |
| SMILES | CC(O)CN(CCNC1CCN(C)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H31N3O3/c1-12(19)10-18(14(20)21-15(2,3)4)9-7-16-13-6-8-17(5)11-13/h12-13,16,19H,6-11H2,1-5H3 |
| InChIKey | WFWQDQYXOPXECO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |