C13H28N2O2 — CID 117003967
tert-butyl N-(3-aminopropyl)-N-(3-methylbutyl)carbamate (PubChem CID 117003967) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is tert-butyl N-(3-aminopropyl)-N-(3-methylbutyl)carbamate.
| Compound Name | tert-butyl N-(3-aminopropyl)-N-(3-methylbutyl)carbamate |
|---|---|
| PubChem CID | 117003967 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | tert-butyl N-(3-aminopropyl)-N-(3-methylbutyl)carbamate |
| SMILES | CC(C)CCN(CCCN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-11(2)7-10-15(9-6-8-14)12(16)17-13(3,4)5/h11H,6-10,14H2,1-5H3 |
| InChIKey | ULFYKPIWQQJLBS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |