About tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene
tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene (PubChem CID 143879621) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene.
Molecular Properties
| Compound Name | tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene |
| PubChem CID | 143879621 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene |
| SMILES | C=CC.CCN(CCC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25NO2.C3H6/c1-7-13(9-8-10(2)3)11(14)15-12(4,5)6;1-3-2/h10H,7-9H2,1-6H3;3H,1H2,2H3 |
| InChIKey | WFSGYGYIBNHHCP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene?
The IUPAC name of tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene (CID 143879621) is tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene.
What is the SMILES notation for tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene?
The canonical SMILES for tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene is C=CC.CCN(CCC(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene?
The InChIKey is WFSGYGYIBNHHCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2.C3H6/c1-7-13(9-8-10(2)3)11(14)15-12(4,5)6;1-3-2/h10H,7-9H2,1-6H3;3H,1H2,2H3.
What are the key properties of tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene?
tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene has a molecular weight of 257.42 g/mol, XLogP of 4.48, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-ethyl-N-(3-methylbutyl)carbamate;prop-1-ene is sourced from PubChem (CID 143879621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).