C13H25NO3 — CID 143752017
acetaldehyde;acetylene;tert-butyl N,N-diethylcarbamate (PubChem CID 143752017) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is acetaldehyde;acetylene;tert-butyl N,N-diethylcarbamate.
| Compound Name | acetaldehyde;acetylene;tert-butyl N,N-diethylcarbamate |
|---|---|
| PubChem CID | 143752017 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | acetaldehyde;acetylene;tert-butyl N,N-diethylcarbamate |
| SMILES | C#C.CC=O.CCN(CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H19NO2.C2H4O.C2H2/c1-6-10(7-2)8(11)12-9(3,4)5;1-2-3;1-2/h6-7H2,1-5H3;2H,1H3;1-2H |
| InChIKey | IXGHDMOTLZKSMF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|