C33H67N5O6 — CID 57136668
tert-butyl N,N-bis[2-[7-aminoheptyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]carbamate (PubChem CID 57136668) has the molecular formula C33H67N5O6 and a molecular weight of 629.93 g/mol. Its IUPAC name is tert-butyl N,N-bis[2-[7-aminoheptyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N,N-bis[2-[7-aminoheptyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 57136668 |
| Molecular Formula | C33H67N5O6 |
| Molecular Weight | 629.93 g/mol |
| Exact Mass | 629.51 |
| IUPAC Name | tert-butyl N,N-bis[2-[7-aminoheptyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCCCCN)CCN(CCN(CCCCCCCN)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H67N5O6/c1-31(2,3)42-28(39)36(22-18-14-10-12-16-20-34)24-26-38(30(41)44-33(7,8)9)27-25-37(29(40)43-32(4,5)6)23-19-15-11-13-17-21-35/h10-27,34-35H2,1-9H3 |
| InChIKey | SGKSSCZCWODESM-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 140.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.93 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|