C17H39N5O2 — CID 102240584
tert-butyl N,N-bis[3-(3-aminopropylamino)propyl]carbamate (PubChem CID 102240584) has the molecular formula C17H39N5O2 and a molecular weight of 345.53 g/mol. Its IUPAC name is tert-butyl N,N-bis[3-(3-aminopropylamino)propyl]carbamate.
| Compound Name | tert-butyl N,N-bis[3-(3-aminopropylamino)propyl]carbamate |
|---|---|
| PubChem CID | 102240584 |
| Molecular Formula | C17H39N5O2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.31 |
| IUPAC Name | tert-butyl N,N-bis[3-(3-aminopropylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCNCCCN)CCCNCCCN |
| InChI | InChI=1S/C17H39N5O2/c1-17(2,3)24-16(23)22(14-6-12-20-10-4-8-18)15-7-13-21-11-5-9-19/h20-21H,4-15,18-19H2,1-3H3 |
| InChIKey | YJYRWBRBPHOHAY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|