C17H41N7O2 — CID 102129204
tert-butyl N,N-bis[2-[2-(2-aminoethylamino)ethylamino]ethyl]carbamate (PubChem CID 102129204) has the molecular formula C17H41N7O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is tert-butyl N,N-bis[2-[2-(2-aminoethylamino)ethylamino]ethyl]carbamate.
| Compound Name | tert-butyl N,N-bis[2-[2-(2-aminoethylamino)ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 102129204 |
| Molecular Formula | C17H41N7O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.33 |
| IUPAC Name | tert-butyl N,N-bis[2-[2-(2-aminoethylamino)ethylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNCCNCCN)CCNCCNCCN |
| InChI | InChI=1S/C17H41N7O2/c1-17(2,3)26-16(25)24(14-12-22-10-8-20-6-4-18)15-13-23-11-9-21-7-5-19/h20-23H,4-15,18-19H2,1-3H3 |
| InChIKey | NPBSCXJROIWEPA-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|