C12H27BN3O3 — CID 89032167
CID 89032167 (PubChem CID 89032167) has the molecular formula C12H27BN3O3 and a molecular weight of 272.18 g/mol.
| Compound Name | CID 89032167 |
|---|---|
| PubChem CID | 89032167 |
| Molecular Formula | C12H27BN3O3 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | — |
| SMILES | CO[B]NCCCN(CCCN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H27BN3O3/c1-12(2,3)19-11(17)16(9-5-7-14)10-6-8-15-13-18-4/h15H,5-10,14H2,1-4H3 |
| InChIKey | KXRTUZJPZOUGHA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|